C12H15NS — CID 125494228
(5aS)-5a,6,7,8,9,11-hexahydropyrido[2,1-b][1,3]benzothiazine (PubChem CID 125494228) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is (5aS)-5a,6,7,8,9,11-hexahydropyrido[2,1-b][1,3]benzothiazine.
| Compound Name | (5aS)-5a,6,7,8,9,11-hexahydropyrido[2,1-b][1,3]benzothiazine |
|---|---|
| PubChem CID | 125494228 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (5aS)-5a,6,7,8,9,11-hexahydropyrido[2,1-b][1,3]benzothiazine |
| SMILES | c1ccc2c(c1)CN1CCCC[C@@H]1S2 |
| InChI | InChI=1S/C12H15NS/c1-2-6-11-10(5-1)9-13-8-4-3-7-12(13)14-11/h1-2,5-6,12H,3-4,7-9H2/t12-/m0/s1 |
| InChIKey | QZXYDSGAVPZDOU-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |