About (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol
(5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol (PubChem CID 125494468) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol.
Molecular Properties
| Compound Name | (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol |
| PubChem CID | 125494468 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol |
| SMILES | N[C@@H]1C[C@@H](O)c2cccnc21 |
| InChI | InChI=1S/C8H10N2O/c9-6-4-7(11)5-2-1-3-10-8(5)6/h1-3,6-7,11H,4,9H2/t6-,7-/m1/s1 |
| InChIKey | VDJYQVKOODKLKM-RNFRBKRXSA-N |
| XLogP | 0.52 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The IUPAC name of (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol (CID 125494468) is (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol.
What is the SMILES notation for (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The canonical SMILES for (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol is N[C@@H]1C[C@@H](O)c2cccnc21.
What is the InChIKey of (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
The InChIKey is VDJYQVKOODKLKM-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H10N2O/c9-6-4-7(11)5-2-1-3-10-8(5)6/h1-3,6-7,11H,4,9H2/t6-,7-/m1/s1.
What are the key properties of (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol?
(5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol has a molecular weight of 150.18 g/mol, XLogP of 0.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,7R)-7-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-ol is sourced from PubChem (CID 125494468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).