C18H20N2O2 — CID 125494655
(5S)-5-(1-methylpiperidin-4-yl)chromeno[2,3-c]pyridin-5-ol (PubChem CID 125494655) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (5S)-5-(1-methylpiperidin-4-yl)chromeno[2,3-c]pyridin-5-ol.
| Compound Name | (5S)-5-(1-methylpiperidin-4-yl)chromeno[2,3-c]pyridin-5-ol |
|---|---|
| PubChem CID | 125494655 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (5S)-5-(1-methylpiperidin-4-yl)chromeno[2,3-c]pyridin-5-ol |
| SMILES | CN1CCC([C@]2(O)c3ccccc3Oc3cnccc32)CC1 |
| InChI | InChI=1S/C18H20N2O2/c1-20-10-7-13(8-11-20)18(21)14-4-2-3-5-16(14)22-17-12-19-9-6-15(17)18/h2-6,9,12-13,21H,7-8,10-11H2,1H3/t18-/m0/s1 |
| InChIKey | YRWLTXBGSCCHMC-SFHVURJKSA-N |
| XLogP | 2.77 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |