C17H19N3O — CID 125494862
8-[(3R)-oxan-3-yl]-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine (PubChem CID 125494862) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 8-[(3R)-oxan-3-yl]-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine.
| Compound Name | 8-[(3R)-oxan-3-yl]-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
|---|---|
| PubChem CID | 125494862 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 8-[(3R)-oxan-3-yl]-6,11-dihydro-5H-pyrido[3,2-c][1,5]benzodiazepine |
| SMILES | c1cnc2c(c1)CNc1cc([C@H]3CCCOC3)ccc1N2 |
| InChI | InChI=1S/C17H19N3O/c1-3-13-10-19-16-9-12(14-4-2-8-21-11-14)5-6-15(16)20-17(13)18-7-1/h1,3,5-7,9,14,19H,2,4,8,10-11H2,(H,18,20)/t14-/m0/s1 |
| InChIKey | HFWLQFMIDJMPQF-AWEZNQCLSA-N |
| XLogP | 3.64 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |