C17H21NOS — CID 125494876
(R)-(4-cyclohexylphenyl)-(3-methyl-1,2-thiazol-5-yl)methanol (PubChem CID 125494876) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is (R)-(4-cyclohexylphenyl)-(3-methyl-1,2-thiazol-5-yl)methanol.
| Compound Name | (R)-(4-cyclohexylphenyl)-(3-methyl-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 125494876 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (R)-(4-cyclohexylphenyl)-(3-methyl-1,2-thiazol-5-yl)methanol |
| SMILES | Cc1cc([C@H](O)c2ccc(C3CCCCC3)cc2)sn1 |
| InChI | InChI=1S/C17H21NOS/c1-12-11-16(20-18-12)17(19)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h7-11,13,17,19H,2-6H2,1H3/t17-/m1/s1 |
| InChIKey | ONLBFANSYDLLQO-QGZVFWFLSA-N |
| XLogP | 4.58 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |