About methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate
methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate (PubChem CID 125495044) has the molecular formula C9H7F3N2O4
and a molecular weight of 264.16 g/mol. Its IUPAC name is methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate |
| PubChem CID | 125495044 |
| Molecular Formula | C9H7F3N2O4 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C=O)ncnc1OCC(F)(F)F |
| InChI | InChI=1S/C9H7F3N2O4/c1-17-8(16)6-5(2-15)13-4-14-7(6)18-3-9(10,11)12/h2,4H,3H2,1H3 |
| InChIKey | FCKBMIVZXSHPFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate?
The IUPAC name of methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate (CID 125495044) is methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate.
What is the SMILES notation for methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate?
The canonical SMILES for methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate is COC(=O)c1c(C=O)ncnc1OCC(F)(F)F.
What is the InChIKey of methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate?
The InChIKey is FCKBMIVZXSHPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N2O4/c1-17-8(16)6-5(2-15)13-4-14-7(6)18-3-9(10,11)12/h2,4H,3H2,1H3.
What are the key properties of methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate?
methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate has a molecular weight of 264.16 g/mol, XLogP of 1.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-formyl-6-(2,2,2-trifluoroethoxy)pyrimidine-5-carboxylate is sourced from PubChem (CID 125495044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).