C9H12N2O — CID 12549514
6-methoxy-1,2,3,4-tetrahydroquinoxaline (PubChem CID 12549514) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 12549514 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydroquinoxaline |
| SMILES | COc1ccc2c(c1)NCCN2 |
| InChI | InChI=1S/C9H12N2O/c1-12-7-2-3-8-9(6-7)11-5-4-10-8/h2-3,6,10-11H,4-5H2,1H3 |
| InChIKey | SXRFQDARJDXESM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|