C12H12ClNO2 — CID 125495379
(4aR)-6-chloro-4a-hydroperoxy-1,2,3,4-tetrahydrocarbazole (PubChem CID 125495379) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is (4aR)-6-chloro-4a-hydroperoxy-1,2,3,4-tetrahydrocarbazole.
| Compound Name | (4aR)-6-chloro-4a-hydroperoxy-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 125495379 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (4aR)-6-chloro-4a-hydroperoxy-1,2,3,4-tetrahydrocarbazole |
| SMILES | OO[C@@]12CCCCC1=Nc1ccc(Cl)cc12 |
| InChI | InChI=1S/C12H12ClNO2/c13-8-4-5-10-9(7-8)12(16-15)6-2-1-3-11(12)14-10/h4-5,7,15H,1-3,6H2/t12-/m1/s1 |
| InChIKey | KIVYTSNBMZIYIK-GFCCVEGCSA-N |
| XLogP | 3.68 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|