About (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene
(1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene (PubChem CID 125495570) has the molecular formula C10H11BrO2
and a molecular weight of 243.10 g/mol. Its IUPAC name is (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene |
| PubChem CID | 125495570 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene |
| SMILES | CO[C@@H]1OCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H11BrO2/c1-12-10-9-3-2-8(11)6-7(9)4-5-13-10/h2-3,6,10H,4-5H2,1H3/t10-/m1/s1 |
| InChIKey | WJYYTMSASRFWTQ-SNVBAGLBSA-N |
| XLogP | 2.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene?
The IUPAC name of (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene (CID 125495570) is (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene.
What is the SMILES notation for (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene?
The canonical SMILES for (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene is CO[C@@H]1OCCc2cc(Br)ccc21.
What is the InChIKey of (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene?
The InChIKey is WJYYTMSASRFWTQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H11BrO2/c1-12-10-9-3-2-8(11)6-7(9)4-5-13-10/h2-3,6,10H,4-5H2,1H3/t10-/m1/s1.
What are the key properties of (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene?
(1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene has a molecular weight of 243.10 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-6-bromo-1-methoxy-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 125495570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).