About 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid
9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid (PubChem CID 125495946) has the molecular formula C12H7FO3S
and a molecular weight of 250.25 g/mol. Its IUPAC name is 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid.
Molecular Properties
| Compound Name | 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| PubChem CID | 125495946 |
| Molecular Formula | C12H7FO3S |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c(s1)-c1c(F)cccc1OC2 |
| InChI | InChI=1S/C12H7FO3S/c13-7-2-1-3-8-10(7)11-6(5-16-8)4-9(17-11)12(14)15/h1-4H,5H2,(H,14,15) |
| InChIKey | ASHABENEVNNKEH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The IUPAC name of 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid (CID 125495946) is 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid.
What is the SMILES notation for 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The canonical SMILES for 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid is O=C(O)c1cc2c(s1)-c1c(F)cccc1OC2.
What is the InChIKey of 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The InChIKey is ASHABENEVNNKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FO3S/c13-7-2-1-3-8-10(7)11-6(5-16-8)4-9(17-11)12(14)15/h1-4H,5H2,(H,14,15).
What are the key properties of 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid?
9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid has a molecular weight of 250.25 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-4H-thieno[3,2-c]chromene-2-carboxylic acid is sourced from PubChem (CID 125495946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).