About 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane
4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane (PubChem CID 12549598) has the molecular formula C6H10Cl2O2S
and a molecular weight of 217.12 g/mol. Its IUPAC name is 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane.
Molecular Properties
| Compound Name | 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane |
| PubChem CID | 12549598 |
| Molecular Formula | C6H10Cl2O2S |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane |
| SMILES | CC1OC(CCl)SC(CCl)O1 |
| InChI | InChI=1S/C6H10Cl2O2S/c1-4-9-5(2-7)11-6(3-8)10-4/h4-6H,2-3H2,1H3 |
| InChIKey | KGJCAPNMTQADJY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane?
The IUPAC name of 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane (CID 12549598) is 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane.
What is the SMILES notation for 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane?
The canonical SMILES for 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane is CC1OC(CCl)SC(CCl)O1.
What is the InChIKey of 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane?
The InChIKey is KGJCAPNMTQADJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O2S/c1-4-9-5(2-7)11-6(3-8)10-4/h4-6H,2-3H2,1H3.
What are the key properties of 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane?
4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane has a molecular weight of 217.12 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(chloromethyl)-2-methyl-1,3,5-dioxathiane is sourced from PubChem (CID 12549598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).