C13H17N3O2 — CID 125496316
(2S)-2-(1H-benzimidazol-2-yl)-1-methylpiperidine-4,4-diol (PubChem CID 125496316) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (2S)-2-(1H-benzimidazol-2-yl)-1-methylpiperidine-4,4-diol.
| Compound Name | (2S)-2-(1H-benzimidazol-2-yl)-1-methylpiperidine-4,4-diol |
|---|---|
| PubChem CID | 125496316 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (2S)-2-(1H-benzimidazol-2-yl)-1-methylpiperidine-4,4-diol |
| SMILES | CN1CCC(O)(O)C[C@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H17N3O2/c1-16-7-6-13(17,18)8-11(16)12-14-9-4-2-3-5-10(9)15-12/h2-5,11,17-18H,6-8H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | QITOPSYAKGWEKR-NSHDSACASA-N |
| XLogP | 1.01 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|