C12H9F7O2S — CID 125496599
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-methylsulfanylbenzoic acid (PubChem CID 125496599) has the molecular formula C12H9F7O2S and a molecular weight of 350.26 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-methylsulfanylbenzoic acid.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 125496599 |
| Molecular Formula | C12H9F7O2S |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-methylsulfanylbenzoic acid |
| SMILES | CSc1c(C(F)(C(F)(F)F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C12H9F7O2S/c1-5-6(9(20)21)3-4-7(8(5)22-2)10(13,11(14,15)16)12(17,18)19/h3-4H,1-2H3,(H,20,21) |
| InChIKey | BWHCIIWTBRIJMZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |