C13H11F7O2S — CID 125496713
3-ethylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid (PubChem CID 125496713) has the molecular formula C13H11F7O2S and a molecular weight of 364.28 g/mol. Its IUPAC name is 3-ethylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid.
| Compound Name | 3-ethylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 125496713 |
| Molecular Formula | C13H11F7O2S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 3-ethylsulfanyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
| SMILES | CCSc1c(C(F)(C(F)(F)F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H11F7O2S/c1-3-23-9-6(2)7(10(21)22)4-5-8(9)11(14,12(15,16)17)13(18,19)20/h4-5H,3H2,1-2H3,(H,21,22) |
| InChIKey | HCUYGOAWRHDYLA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |