C14H13F7O2S — CID 125496856
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-propan-2-ylsulfanylbenzoic acid (PubChem CID 125496856) has the molecular formula C14H13F7O2S and a molecular weight of 378.31 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-propan-2-ylsulfanylbenzoic acid.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-propan-2-ylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 125496856 |
| Molecular Formula | C14H13F7O2S |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methyl-3-propan-2-ylsulfanylbenzoic acid |
| SMILES | Cc1c(C(=O)O)ccc(C(F)(C(F)(F)F)C(F)(F)F)c1SC(C)C |
| InChI | InChI=1S/C14H13F7O2S/c1-6(2)24-10-7(3)8(11(22)23)4-5-9(10)12(15,13(16,17)18)14(19,20)21/h4-6H,1-3H3,(H,22,23) |
| InChIKey | LJQYAZUPTSCPSX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |