C16H17F7O2S — CID 125496863
2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(2-methylpropylsulfanyl)benzoic acid (PubChem CID 125496863) has the molecular formula C16H17F7O2S and a molecular weight of 406.36 g/mol. Its IUPAC name is 2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(2-methylpropylsulfanyl)benzoic acid.
| Compound Name | 2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(2-methylpropylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 125496863 |
| Molecular Formula | C16H17F7O2S |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-3-(2-methylpropylsulfanyl)benzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(C(F)(C(F)(F)F)C(F)(F)F)c1SCC(C)C |
| InChI | InChI=1S/C16H17F7O2S/c1-4-9-10(13(24)25)5-6-11(12(9)26-7-8(2)3)14(17,15(18,19)20)16(21,22)23/h5-6,8H,4,7H2,1-3H3,(H,24,25) |
| InChIKey | LUCAYPQGWNVYFO-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |