About N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide
N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide (PubChem CID 125497927) has the molecular formula C9H10F2N4O3S
and a molecular weight of 292.27 g/mol. Its IUPAC name is N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide.
Molecular Properties
| Compound Name | N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide |
| PubChem CID | 125497927 |
| Molecular Formula | C9H10F2N4O3S |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1ccc(F)c(N=[N+]=[N-])c1F |
| InChI | InChI=1S/C9H10F2N4O3S/c1-18-4-5-19(16,17)14-7-3-2-6(10)9(8(7)11)13-15-12/h2-3,14H,4-5H2,1H3 |
| InChIKey | IUGCOFJFFKUQER-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide?
The IUPAC name of N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide (CID 125497927) is N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide.
What is the SMILES notation for N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide?
The canonical SMILES for N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide is COCCS(=O)(=O)Nc1ccc(F)c(N=[N+]=[N-])c1F.
What is the InChIKey of N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide?
The InChIKey is IUGCOFJFFKUQER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N4O3S/c1-18-4-5-19(16,17)14-7-3-2-6(10)9(8(7)11)13-15-12/h2-3,14H,4-5H2,1H3.
What are the key properties of N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide?
N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide has a molecular weight of 292.27 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-azido-2,4-difluorophenyl)-2-methoxyethanesulfonamide is sourced from PubChem (CID 125497927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).