C10H10F13NO2S — CID 125498317
N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide (PubChem CID 125498317) has the molecular formula C10H10F13NO2S and a molecular weight of 455.24 g/mol. Its IUPAC name is N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide.
| Compound Name | N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide |
|---|---|
| PubChem CID | 125498317 |
| Molecular Formula | C10H10F13NO2S |
| Molecular Weight | 455.24 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | N,N-diethyl-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F13NO2S/c1-3-24(4-2)27(25,26)10(22,23)8(17,18)6(13,14)5(11,12)7(15,16)9(19,20)21/h3-4H2,1-2H3 |
| InChIKey | KRVYEQXJBYQTOX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.24 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|