About N'-methyl-N'-(4-methylphenyl)acetohydrazide
N'-methyl-N'-(4-methylphenyl)acetohydrazide (PubChem CID 125498843) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is N'-methyl-N'-(4-methylphenyl)acetohydrazide.
Molecular Properties
| Compound Name | N'-methyl-N'-(4-methylphenyl)acetohydrazide |
| PubChem CID | 125498843 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N'-methyl-N'-(4-methylphenyl)acetohydrazide |
| SMILES | CC(=O)NN(C)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H14N2O/c1-8-4-6-10(7-5-8)12(3)11-9(2)13/h4-7H,1-3H3,(H,11,13) |
| InChIKey | FUMQITBITYHQSS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-(4-methylphenyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(4-methylphenyl)acetohydrazide?
The IUPAC name of N'-methyl-N'-(4-methylphenyl)acetohydrazide (CID 125498843) is N'-methyl-N'-(4-methylphenyl)acetohydrazide.
What is the SMILES notation for N'-methyl-N'-(4-methylphenyl)acetohydrazide?
The canonical SMILES for N'-methyl-N'-(4-methylphenyl)acetohydrazide is CC(=O)NN(C)c1ccc(C)cc1.
What is the InChIKey of N'-methyl-N'-(4-methylphenyl)acetohydrazide?
The InChIKey is FUMQITBITYHQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O/c1-8-4-6-10(7-5-8)12(3)11-9(2)13/h4-7H,1-3H3,(H,11,13).
What are the key properties of N'-methyl-N'-(4-methylphenyl)acetohydrazide?
N'-methyl-N'-(4-methylphenyl)acetohydrazide has a molecular weight of 178.23 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(4-methylphenyl)acetohydrazide is sourced from PubChem (CID 125498843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).