About [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol
[(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol (PubChem CID 125498897) has the molecular formula C8H18N2S2
and a molecular weight of 206.38 g/mol. Its IUPAC name is [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol.
Molecular Properties
| Compound Name | [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol |
| PubChem CID | 125498897 |
| Molecular Formula | C8H18N2S2 |
| Molecular Weight | 206.38 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol |
| SMILES | CN1C[C@H](CS)N(C)C[C@@H]1CS |
| InChI | InChI=1S/C8H18N2S2/c1-9-3-8(6-12)10(2)4-7(9)5-11/h7-8,11-12H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | PEOQKTQEJNDRBV-HTQZYQBOSA-N |
| XLogP | 0.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol?
The IUPAC name of [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol (CID 125498897) is [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol.
What is the SMILES notation for [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol?
The canonical SMILES for [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol is CN1C[C@H](CS)N(C)C[C@@H]1CS.
What is the InChIKey of [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol?
The InChIKey is PEOQKTQEJNDRBV-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H18N2S2/c1-9-3-8(6-12)10(2)4-7(9)5-11/h7-8,11-12H,3-6H2,1-2H3/t7-,8-/m1/s1.
What are the key properties of [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol?
[(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol has a molecular weight of 206.38 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5R)-1,4-dimethyl-5-(sulfanylmethyl)piperazin-2-yl]methanethiol is sourced from PubChem (CID 125498897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).