C12H15Br — CID 125499315
(1R)-4-bromo-1,2,2-trimethyl-1,3-dihydroindene (PubChem CID 125499315) has the molecular formula C12H15Br and a molecular weight of 239.16 g/mol. Its IUPAC name is (1R)-4-bromo-1,2,2-trimethyl-1,3-dihydroindene.
| Compound Name | (1R)-4-bromo-1,2,2-trimethyl-1,3-dihydroindene |
|---|---|
| PubChem CID | 125499315 |
| Molecular Formula | C12H15Br |
| Molecular Weight | 239.16 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | (1R)-4-bromo-1,2,2-trimethyl-1,3-dihydroindene |
| SMILES | C[C@H]1c2cccc(Br)c2CC1(C)C |
| InChI | InChI=1S/C12H15Br/c1-8-9-5-4-6-11(13)10(9)7-12(8,2)3/h4-6,8H,7H2,1-3H3/t8-/m0/s1 |
| InChIKey | KVLXRFKDMZOMPU-QMMMGPOBSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |