About 1,2-dibenzylguanidine;hydrobromide
1,2-dibenzylguanidine;hydrobromide (PubChem CID 12549981) has the molecular formula C15H18BrN3
and a molecular weight of 320.23 g/mol. Its IUPAC name is 1,2-dibenzylguanidine;hydrobromide.
Molecular Properties
| Compound Name | 1,2-dibenzylguanidine;hydrobromide |
| PubChem CID | 12549981 |
| Molecular Formula | C15H18BrN3 |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 1,2-dibenzylguanidine;hydrobromide |
| SMILES | Br.N/C(=N\Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C15H17N3.BrH/c16-15(17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H3,16,17,18);1H |
| InChIKey | ANPWHFWMANMCEZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dibenzylguanidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dibenzylguanidine;hydrobromide?
The IUPAC name of 1,2-dibenzylguanidine;hydrobromide (CID 12549981) is 1,2-dibenzylguanidine;hydrobromide.
What is the SMILES notation for 1,2-dibenzylguanidine;hydrobromide?
The canonical SMILES for 1,2-dibenzylguanidine;hydrobromide is Br.N/C(=N\Cc1ccccc1)NCc1ccccc1.
What is the InChIKey of 1,2-dibenzylguanidine;hydrobromide?
The InChIKey is ANPWHFWMANMCEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3.BrH/c16-15(17-11-13-7-3-1-4-8-13)18-12-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H3,16,17,18);1H.
What are the key properties of 1,2-dibenzylguanidine;hydrobromide?
1,2-dibenzylguanidine;hydrobromide has a molecular weight of 320.23 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dibenzylguanidine;hydrobromide is sourced from PubChem (CID 12549981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).