About 2-chloroethanesulfinyl chloride
2-chloroethanesulfinyl chloride (PubChem CID 12550052) has the molecular formula C2H4Cl2OS
and a molecular weight of 147.03 g/mol. Its IUPAC name is 2-chloroethanesulfinyl chloride.
Molecular Properties
| Compound Name | 2-chloroethanesulfinyl chloride |
| PubChem CID | 12550052 |
| Molecular Formula | C2H4Cl2OS |
| Molecular Weight | 147.03 g/mol |
| Exact Mass | 145.94 |
| IUPAC Name | 2-chloroethanesulfinyl chloride |
| SMILES | O=S(Cl)CCCl |
| InChI | InChI=1S/C2H4Cl2OS/c3-1-2-6(4)5/h1-2H2 |
| InChIKey | FKUBZQOURSEZDB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.03 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethanesulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethanesulfinyl chloride?
The IUPAC name of 2-chloroethanesulfinyl chloride (CID 12550052) is 2-chloroethanesulfinyl chloride.
What is the SMILES notation for 2-chloroethanesulfinyl chloride?
The canonical SMILES for 2-chloroethanesulfinyl chloride is O=S(Cl)CCCl.
What is the InChIKey of 2-chloroethanesulfinyl chloride?
The InChIKey is FKUBZQOURSEZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2OS/c3-1-2-6(4)5/h1-2H2.
What are the key properties of 2-chloroethanesulfinyl chloride?
2-chloroethanesulfinyl chloride has a molecular weight of 147.03 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethanesulfinyl chloride is sourced from PubChem (CID 12550052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).