2-chloroethanesulfinyl chloride

C2H4Cl2OS — CID 12550052

IUPAC2-chloroethanesulfinyl chloride
SMILESO=S(Cl)CCCl
InChIInChI=1S/C2H4Cl2OS/c3-1-2-6(4)5/h1-2H2
InChIKeyFKUBZQOURSEZDB-UHFFFAOYSA-N
MW147.03 g/mol
LogP1.13
Rot. Bonds2

About 2-chloroethanesulfinyl chloride

2-chloroethanesulfinyl chloride (PubChem CID 12550052) has the molecular formula C2H4Cl2OS and a molecular weight of 147.03 g/mol. Its IUPAC name is 2-chloroethanesulfinyl chloride.

Molecular Properties

Compound Name2-chloroethanesulfinyl chloride
PubChem CID12550052
Molecular FormulaC2H4Cl2OS
Molecular Weight147.03 g/mol
Exact Mass145.94
IUPAC Name2-chloroethanesulfinyl chloride
SMILESO=S(Cl)CCCl
InChIInChI=1S/C2H4Cl2OS/c3-1-2-6(4)5/h1-2H2
InChIKeyFKUBZQOURSEZDB-UHFFFAOYSA-N
XLogP1.13
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.03
LogP ≤ 51.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-chloroethanesulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloroethanesulfinyl chloride?
The IUPAC name of 2-chloroethanesulfinyl chloride (CID 12550052) is 2-chloroethanesulfinyl chloride.
What is the SMILES notation for 2-chloroethanesulfinyl chloride?
The canonical SMILES for 2-chloroethanesulfinyl chloride is O=S(Cl)CCCl.
What is the InChIKey of 2-chloroethanesulfinyl chloride?
The InChIKey is FKUBZQOURSEZDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4Cl2OS/c3-1-2-6(4)5/h1-2H2.
What are the key properties of 2-chloroethanesulfinyl chloride?
2-chloroethanesulfinyl chloride has a molecular weight of 147.03 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethanesulfinyl chloride is sourced from PubChem (CID 12550052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).