About N-butyl-N'-triethylstannylbutanediamide
N-butyl-N'-triethylstannylbutanediamide (PubChem CID 12550555) has the molecular formula C14H30N2O2Sn
and a molecular weight of 377.12 g/mol. Its IUPAC name is N-butyl-N'-triethylstannylbutanediamide.
Molecular Properties
| Compound Name | N-butyl-N'-triethylstannylbutanediamide |
| PubChem CID | 12550555 |
| Molecular Formula | C14H30N2O2Sn |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-butyl-N'-triethylstannylbutanediamide |
| SMILES | CCCCNC(=O)CCC(=O)N[Sn](CC)(CC)CC |
| InChI | InChI=1S/C8H16N2O2.3C2H5.Sn/c1-2-3-6-10-8(12)5-4-7(9)11;3*1-2;/h2-6H2,1H3,(H3,9,10,11,12);3*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | HYUJQPOUZMUEOI-UHFFFAOYSA-M |
| XLogP | 2.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-triethylstannylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-triethylstannylbutanediamide?
The IUPAC name of N-butyl-N'-triethylstannylbutanediamide (CID 12550555) is N-butyl-N'-triethylstannylbutanediamide.
What is the SMILES notation for N-butyl-N'-triethylstannylbutanediamide?
The canonical SMILES for N-butyl-N'-triethylstannylbutanediamide is CCCCNC(=O)CCC(=O)N[Sn](CC)(CC)CC.
What is the InChIKey of N-butyl-N'-triethylstannylbutanediamide?
The InChIKey is HYUJQPOUZMUEOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N2O2.3C2H5.Sn/c1-2-3-6-10-8(12)5-4-7(9)11;3*1-2;/h2-6H2,1H3,(H3,9,10,11,12);3*1H2,2H3;/q;;;;+1/p-1.
What are the key properties of N-butyl-N'-triethylstannylbutanediamide?
N-butyl-N'-triethylstannylbutanediamide has a molecular weight of 377.12 g/mol, XLogP of 2.80, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-triethylstannylbutanediamide is sourced from PubChem (CID 12550555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).