C20H13N3O — CID 12550717
2-(4-methylphenyl)-6-oxo-4-phenyl-1H-pyridine-3,5-dicarbonitrile (PubChem CID 12550717) has the molecular formula C20H13N3O and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(4-methylphenyl)-6-oxo-4-phenyl-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-(4-methylphenyl)-6-oxo-4-phenyl-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 12550717 |
| Molecular Formula | C20H13N3O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(4-methylphenyl)-6-oxo-4-phenyl-1H-pyridine-3,5-dicarbonitrile |
| SMILES | Cc1ccc(-c2[nH]c(=O)c(C#N)c(-c3ccccc3)c2C#N)cc1 |
| InChI | InChI=1S/C20H13N3O/c1-13-7-9-15(10-8-13)19-16(11-21)18(14-5-3-2-4-6-14)17(12-22)20(24)23-19/h2-10H,1H3,(H,23,24) |
| InChIKey | FNALZRGKHNVKEJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |