About ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate
ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate (PubChem CID 12550721) has the molecular formula C21H16N2O3
and a molecular weight of 344.37 g/mol. Its IUPAC name is ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate |
| PubChem CID | 12550721 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)[nH]c(=O)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C21H16N2O3/c1-2-26-21(25)18-17(14-9-5-3-6-10-14)16(13-22)20(24)23-19(18)15-11-7-4-8-12-15/h3-12H,2H2,1H3,(H,23,24) |
| InChIKey | ICCQLGNBBJWZOK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate?
The IUPAC name of ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate (CID 12550721) is ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate.
What is the SMILES notation for ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate?
The canonical SMILES for ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate is CCOC(=O)c1c(-c2ccccc2)[nH]c(=O)c(C#N)c1-c1ccccc1.
What is the InChIKey of ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate?
The InChIKey is ICCQLGNBBJWZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O3/c1-2-26-21(25)18-17(14-9-5-3-6-10-14)16(13-22)20(24)23-19(18)15-11-7-4-8-12-15/h3-12H,2H2,1H3,(H,23,24).
What are the key properties of ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate?
ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate has a molecular weight of 344.37 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-cyano-6-oxo-2,4-diphenyl-1H-pyridine-3-carboxylate is sourced from PubChem (CID 12550721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).