About 3-acetyl-5-methyloxolane-2,4-dione
3-acetyl-5-methyloxolane-2,4-dione (PubChem CID 12551486) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-acetyl-5-methyloxolane-2,4-dione.
Molecular Properties
| Compound Name | 3-acetyl-5-methyloxolane-2,4-dione |
| PubChem CID | 12551486 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 3-acetyl-5-methyloxolane-2,4-dione |
| SMILES | CC(=O)C1C(=O)OC(C)C1=O |
| InChI | InChI=1S/C7H8O4/c1-3(8)5-6(9)4(2)11-7(5)10/h4-5H,1-2H3 |
| InChIKey | AWDQUGUAPKMRFX-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-5-methyloxolane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5-methyloxolane-2,4-dione?
The IUPAC name of 3-acetyl-5-methyloxolane-2,4-dione (CID 12551486) is 3-acetyl-5-methyloxolane-2,4-dione.
What is the SMILES notation for 3-acetyl-5-methyloxolane-2,4-dione?
The canonical SMILES for 3-acetyl-5-methyloxolane-2,4-dione is CC(=O)C1C(=O)OC(C)C1=O.
What is the InChIKey of 3-acetyl-5-methyloxolane-2,4-dione?
The InChIKey is AWDQUGUAPKMRFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c1-3(8)5-6(9)4(2)11-7(5)10/h4-5H,1-2H3.
What are the key properties of 3-acetyl-5-methyloxolane-2,4-dione?
3-acetyl-5-methyloxolane-2,4-dione has a molecular weight of 156.14 g/mol, XLogP of -0.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5-methyloxolane-2,4-dione is sourced from PubChem (CID 12551486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).