C14H20 — CID 12551508
1,4,4a,5,8,8a,9,9a,10,10a-decahydroanthracene (PubChem CID 12551508) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,4,4a,5,8,8a,9,9a,10,10a-decahydroanthracene.
| Compound Name | 1,4,4a,5,8,8a,9,9a,10,10a-decahydroanthracene |
|---|---|
| PubChem CID | 12551508 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,4,4a,5,8,8a,9,9a,10,10a-decahydroanthracene |
| SMILES | C1=CCC2CC3CC=CCC3CC2C1 |
| InChI | InChI=1S/C14H20/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-4,11-14H,5-10H2 |
| InChIKey | YETOGUWATCETMA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|