About [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene
[(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene (PubChem CID 12551972) has the molecular formula C16H22O2S
and a molecular weight of 278.42 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene |
| PubChem CID | 12551972 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene |
| SMILES | CC(C)=CCC/C(C)=C\CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O2S/c1-14(2)8-7-9-15(3)12-13-19(17,18)16-10-5-4-6-11-16/h4-6,8,10-12H,7,9,13H2,1-3H3/b15-12- |
| InChIKey | IULKHBFGJTXXCU-QINSGFPZSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene (CID 12551972) is [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene is CC(C)=CCC/C(C)=C\CS(=O)(=O)c1ccccc1.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene?
The InChIKey is IULKHBFGJTXXCU-QINSGFPZSA-N. The full InChI is InChI=1S/C16H22O2S/c1-14(2)8-7-9-15(3)12-13-19(17,18)16-10-5-4-6-11-16/h4-6,8,10-12H,7,9,13H2,1-3H3/b15-12-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene?
[(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene has a molecular weight of 278.42 g/mol, XLogP of 4.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl]sulfonylbenzene is sourced from PubChem (CID 12551972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).