About 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione
6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione (PubChem CID 12552269) has the molecular formula C7H7FN2O2
and a molecular weight of 170.14 g/mol. Its IUPAC name is 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione.
Molecular Properties
| Compound Name | 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione |
| PubChem CID | 12552269 |
| Molecular Formula | C7H7FN2O2 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione |
| SMILES | CC1=CC2(F)C(=O)NC(=O)NC12 |
| InChI | InChI=1S/C7H7FN2O2/c1-3-2-7(8)4(3)9-6(12)10-5(7)11/h2,4H,1H3,(H2,9,10,11,12) |
| InChIKey | JDMOXYBAFDKHQY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione?
The IUPAC name of 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione (CID 12552269) is 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione.
What is the SMILES notation for 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione?
The canonical SMILES for 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione is CC1=CC2(F)C(=O)NC(=O)NC12.
What is the InChIKey of 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione?
The InChIKey is JDMOXYBAFDKHQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2O2/c1-3-2-7(8)4(3)9-6(12)10-5(7)11/h2,4H,1H3,(H2,9,10,11,12).
What are the key properties of 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione?
6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione has a molecular weight of 170.14 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-8-methyl-2,4-diazabicyclo[4.2.0]oct-7-ene-3,5-dione is sourced from PubChem (CID 12552269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).