About 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one
3-Fluoro-5-methyl-1,2-dihydropyridin-2-one (PubChem CID 12552277) has the molecular formula C6H6FNO
and a molecular weight of 127.12 g/mol. Its IUPAC name is 3-fluoro-5-methyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one |
| PubChem CID | 12552277 |
| Molecular Formula | C6H6FNO |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 3-fluoro-5-methyl-1H-pyridin-2-one |
| SMILES | CC1=CNC(=O)C(=C1)F |
| InChI | InChI=1S/C6H6FNO/c1-4-2-5(7)6(9)8-3-4/h2-3H,1H3,(H,8,9) |
| InChIKey | DGEJXOUYBQECRG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 205 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one?
The IUPAC name of 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one (CID 12552277) is 3-fluoro-5-methyl-1H-pyridin-2-one.
What is the SMILES notation for 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one?
The canonical SMILES for 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one is CC1=CNC(=O)C(=C1)F.
What is the InChIKey of 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one?
The InChIKey is DGEJXOUYBQECRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO/c1-4-2-5(7)6(9)8-3-4/h2-3H,1H3,(H,8,9).
What are the key properties of 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one?
3-Fluoro-5-methyl-1,2-dihydropyridin-2-one has a molecular weight of 127.12 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Fluoro-5-methyl-1,2-dihydropyridin-2-one is sourced from PubChem (CID 12552277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).