C16H15NO — CID 12552296
17-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-1-ol (PubChem CID 12552296) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 17-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-1-ol.
| Compound Name | 17-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-1-ol |
|---|---|
| PubChem CID | 12552296 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 17-azatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaen-1-ol |
| SMILES | OC12NC(Cc3ccccc31)Cc1ccccc12 |
| InChI | InChI=1S/C16H15NO/c18-16-14-7-3-1-5-11(14)9-13(17-16)10-12-6-2-4-8-15(12)16/h1-8,13,17-18H,9-10H2 |
| InChIKey | NIGZWJTYZFTTPX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |