About copper(1+);N,N-dimethyl-1-phenylmethanamine
copper(1+);N,N-dimethyl-1-phenylmethanamine (PubChem CID 12552340) has the molecular formula C9H12CuN
and a molecular weight of 197.75 g/mol. Its IUPAC name is copper(1+);N,N-dimethyl-1-phenylmethanamine.
Molecular Properties
| Compound Name | copper(1+);N,N-dimethyl-1-phenylmethanamine |
| PubChem CID | 12552340 |
| Molecular Formula | C9H12CuN |
| Molecular Weight | 197.75 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | copper(1+);N,N-dimethyl-1-phenylmethanamine |
| SMILES | CN(C)Cc1[c-]cccc1.[Cu+] |
| InChI | InChI=1S/C9H12N.Cu/c1-10(2)8-9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1;+1 |
| InChIKey | MVPYYSYCAKMWSO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.75 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);N,N-dimethyl-1-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);N,N-dimethyl-1-phenylmethanamine?
The IUPAC name of copper(1+);N,N-dimethyl-1-phenylmethanamine (CID 12552340) is copper(1+);N,N-dimethyl-1-phenylmethanamine.
What is the SMILES notation for copper(1+);N,N-dimethyl-1-phenylmethanamine?
The canonical SMILES for copper(1+);N,N-dimethyl-1-phenylmethanamine is CN(C)Cc1[c-]cccc1.[Cu+].
What is the InChIKey of copper(1+);N,N-dimethyl-1-phenylmethanamine?
The InChIKey is MVPYYSYCAKMWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Cu/c1-10(2)8-9-6-4-3-5-7-9;/h3-6H,8H2,1-2H3;/q-1;+1.
What are the key properties of copper(1+);N,N-dimethyl-1-phenylmethanamine?
copper(1+);N,N-dimethyl-1-phenylmethanamine has a molecular weight of 197.75 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);N,N-dimethyl-1-phenylmethanamine is sourced from PubChem (CID 12552340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).