C11H7NOS2 — CID 12553250
6-phenyl-[1,3]thiazolo[2,3-b][1,3]thiazol-5-one (PubChem CID 12553250) has the molecular formula C11H7NOS2 and a molecular weight of 233.32 g/mol. Its IUPAC name is 6-phenyl-[1,3]thiazolo[2,3-b][1,3]thiazol-5-one.
| Compound Name | 6-phenyl-[1,3]thiazolo[2,3-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 12553250 |
| Molecular Formula | C11H7NOS2 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 6-phenyl-[1,3]thiazolo[2,3-b][1,3]thiazol-5-one |
| SMILES | O=C1C(c2ccccc2)=S=C2SC=CN12 |
| InChI | InChI=1S/C11H7NOS2/c13-10-9(8-4-2-1-3-5-8)15-11-12(10)6-7-14-11/h1-7H |
| InChIKey | KEUNKZWDZAOAAM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|