About methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate
methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate (PubChem CID 1255326) has the molecular formula C23H17N3O5
and a molecular weight of 415.41 g/mol. Its IUPAC name is methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate |
| PubChem CID | 1255326 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)c1 |
| InChI | InChI=1S/C23H17N3O5/c1-31-23(30)16-5-2-6-17(10-16)25-20(27)15-7-8-18-19(11-15)22(29)26(21(18)28)13-14-4-3-9-24-12-14/h2-12H,13H2,1H3,(H,25,27) |
| InChIKey | MJNFTNIUCYDIQS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate?
The IUPAC name of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate (CID 1255326) is methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate.
What is the SMILES notation for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate?
The canonical SMILES for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate is COC(=O)c1cccc(NC(=O)c2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)c1.
What is the InChIKey of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate?
The InChIKey is MJNFTNIUCYDIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O5/c1-31-23(30)16-5-2-6-17(10-16)25-20(27)15-7-8-18-19(11-15)22(29)26(21(18)28)13-14-4-3-9-24-12-14/h2-12H,13H2,1H3,(H,25,27).
What are the key properties of methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate?
methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate has a molecular weight of 415.41 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carbonyl]amino]benzoate is sourced from PubChem (CID 1255326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).