5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid

C15H16O4 — CID 12553359

IUPAC5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid
SMILESO=C(O)C1C2CC(c3ccccc3)C(C2)C1C(=O)O
InChIInChI=1S/C15H16O4/c16-14(17)12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(18)19/h1-5,9-13H,6-7H2,(H,16,17)(H,18,19)
InChIKeyFVOPGJHWZNSVSQ-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.21
Rot. Bonds3

About 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid

5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 12553359) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid.

Molecular Properties

Compound Name5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid
PubChem CID12553359
Molecular FormulaC15H16O4
Molecular Weight260.29 g/mol
Exact Mass260.10
IUPAC Name5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid
SMILESO=C(O)C1C2CC(c3ccccc3)C(C2)C1C(=O)O
InChIInChI=1S/C15H16O4/c16-14(17)12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(18)19/h1-5,9-13H,6-7H2,(H,16,17)(H,18,19)
InChIKeyFVOPGJHWZNSVSQ-UHFFFAOYSA-N
XLogP2.21
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The IUPAC name of 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CID 12553359) is 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
What is the SMILES notation for 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The canonical SMILES for 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid is O=C(O)C1C2CC(c3ccccc3)C(C2)C1C(=O)O.
What is the InChIKey of 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The InChIKey is FVOPGJHWZNSVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c16-14(17)12-9-6-10(8-4-2-1-3-5-8)11(7-9)13(12)15(18)19/h1-5,9-13H,6-7H2,(H,16,17)(H,18,19).
What are the key properties of 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid has a molecular weight of 260.29 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylbicyclo[2.2.1]heptane-2,3-dicarboxylic acid is sourced from PubChem (CID 12553359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).