About 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine
5-diethoxyphosphoryl-2,4-dimethoxypyrimidine (PubChem CID 12553989) has the molecular formula C10H17N2O5P
and a molecular weight of 276.23 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine |
| PubChem CID | 12553989 |
| Molecular Formula | C10H17N2O5P |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine |
| SMILES | CCOP(=O)(OCC)c1cnc(OC)nc1OC |
| InChI | InChI=1S/C10H17N2O5P/c1-5-16-18(13,17-6-2)8-7-11-10(15-4)12-9(8)14-3/h7H,5-6H2,1-4H3 |
| InChIKey | MNCPGPVMTNLTIN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine?
The IUPAC name of 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine (CID 12553989) is 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine.
What is the SMILES notation for 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine?
The canonical SMILES for 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine is CCOP(=O)(OCC)c1cnc(OC)nc1OC.
What is the InChIKey of 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine?
The InChIKey is MNCPGPVMTNLTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2O5P/c1-5-16-18(13,17-6-2)8-7-11-10(15-4)12-9(8)14-3/h7H,5-6H2,1-4H3.
What are the key properties of 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine?
5-diethoxyphosphoryl-2,4-dimethoxypyrimidine has a molecular weight of 276.23 g/mol, XLogP of 1.39, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diethoxyphosphoryl-2,4-dimethoxypyrimidine is sourced from PubChem (CID 12553989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).