C14H20 — CID 12554015
(1S,6R)-7-[(1R,6S)-7-bicyclo[4.1.0]heptanylidene]bicyclo[4.1.0]heptane (PubChem CID 12554015) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (1S,6R)-7-[(1R,6S)-7-bicyclo[4.1.0]heptanylidene]bicyclo[4.1.0]heptane.
| Compound Name | (1S,6R)-7-[(1R,6S)-7-bicyclo[4.1.0]heptanylidene]bicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 12554015 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (1S,6R)-7-[(1R,6S)-7-bicyclo[4.1.0]heptanylidene]bicyclo[4.1.0]heptane |
| SMILES | C1CC[C@H]2/C(=C3\[C@H]4CCCC[C@@H]34)[C@H]2C1 |
| InChI | InChI=1S/C14H20/c1-2-6-10-9(5-1)13(10)14-11-7-3-4-8-12(11)14/h9-12H,1-8H2/b14-13-/t9-,10+,11+,12- |
| InChIKey | PGJOOQCXPNHXDI-WXZYHPHRSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|