About thieno[3,2-c]pyridazine
thieno[3,2-c]pyridazine (PubChem CID 12554265) has the molecular formula C6H4N2S
and a molecular weight of 136.18 g/mol. Its IUPAC name is thieno[3,2-c]pyridazine.
Molecular Properties
| Compound Name | thieno[3,2-c]pyridazine |
| PubChem CID | 12554265 |
| Molecular Formula | C6H4N2S |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.01 |
| IUPAC Name | thieno[3,2-c]pyridazine |
| SMILES | c1cc2sccc2nn1 |
| InChI | InChI=1S/C6H4N2S/c1-3-7-8-5-2-4-9-6(1)5/h1-4H |
| InChIKey | IZAJCEGIQMYVFM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thieno[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-c]pyridazine?
The IUPAC name of thieno[3,2-c]pyridazine (CID 12554265) is thieno[3,2-c]pyridazine.
What is the SMILES notation for thieno[3,2-c]pyridazine?
The canonical SMILES for thieno[3,2-c]pyridazine is c1cc2sccc2nn1.
What is the InChIKey of thieno[3,2-c]pyridazine?
The InChIKey is IZAJCEGIQMYVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2S/c1-3-7-8-5-2-4-9-6(1)5/h1-4H.
What are the key properties of thieno[3,2-c]pyridazine?
thieno[3,2-c]pyridazine has a molecular weight of 136.18 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-c]pyridazine is sourced from PubChem (CID 12554265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).