About 3-ethyl-2-propylfuran
3-ethyl-2-propylfuran (PubChem CID 12555083) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 3-ethyl-2-propylfuran.
Molecular Properties
| Compound Name | 3-ethyl-2-propylfuran |
| PubChem CID | 12555083 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 3-ethyl-2-propylfuran |
| SMILES | CCCc1occc1CC |
| InChI | InChI=1S/C9H14O/c1-3-5-9-8(4-2)6-7-10-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | XBOWTCYVPAVSOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2-propylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-propylfuran?
The IUPAC name of 3-ethyl-2-propylfuran (CID 12555083) is 3-ethyl-2-propylfuran.
What is the SMILES notation for 3-ethyl-2-propylfuran?
The canonical SMILES for 3-ethyl-2-propylfuran is CCCc1occc1CC.
What is the InChIKey of 3-ethyl-2-propylfuran?
The InChIKey is XBOWTCYVPAVSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-3-5-9-8(4-2)6-7-10-9/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-ethyl-2-propylfuran?
3-ethyl-2-propylfuran has a molecular weight of 138.21 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-propylfuran is sourced from PubChem (CID 12555083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).