C16H13ClF2N2O4 — CID 1255523
(3R)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(furan-2-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 1255523) has the molecular formula C16H13ClF2N2O4 and a molecular weight of 370.74 g/mol. Its IUPAC name is (3R)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(furan-2-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(furan-2-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1255523 |
| Molecular Formula | C16H13ClF2N2O4 |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (3R)-1-[4-[chloro(difluoro)methoxy]phenyl]-3-(furan-2-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](NCc2ccco2)C(=O)N1c1ccc(OC(F)(F)Cl)cc1 |
| InChI | InChI=1S/C16H13ClF2N2O4/c17-16(18,19)25-11-5-3-10(4-6-11)21-14(22)8-13(15(21)23)20-9-12-2-1-7-24-12/h1-7,13,20H,8-9H2/t13-/m1/s1 |
| InChIKey | ANENHNHLHYYZDT-CYBMUJFWSA-N |
| XLogP | 2.87 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|