About 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile
3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile (PubChem CID 12555919) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile |
| PubChem CID | 12555919 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile |
| SMILES | CO[C@@H]1CCCC[C@@H]1CCC#N |
| InChI | InChI=1S/C10H17NO/c1-12-10-7-3-2-5-9(10)6-4-8-11/h9-10H,2-7H2,1H3/t9-,10-/m1/s1 |
| InChIKey | ZXJSCMAUPIBRON-NXEZZACHSA-N |
| XLogP | 2.50 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile?
The IUPAC name of 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile (CID 12555919) is 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile.
What is the SMILES notation for 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile?
The canonical SMILES for 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile is CO[C@@H]1CCCC[C@@H]1CCC#N.
What is the InChIKey of 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile?
The InChIKey is ZXJSCMAUPIBRON-NXEZZACHSA-N. The full InChI is InChI=1S/C10H17NO/c1-12-10-7-3-2-5-9(10)6-4-8-11/h9-10H,2-7H2,1H3/t9-,10-/m1/s1.
What are the key properties of 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile?
3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile has a molecular weight of 167.25 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-2-methoxycyclohexyl]propanenitrile is sourced from PubChem (CID 12555919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).