C10H7N7O4 — CID 1255619
methyl 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 1255619) has the molecular formula C10H7N7O4 and a molecular weight of 289.21 g/mol. Its IUPAC name is methyl 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 1255619 |
| Molecular Formula | C10H7N7O4 |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | methyl 6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc2ncc(-n3cc([N+](=O)[O-])cn3)cn2n1 |
| InChI | InChI=1S/C10H7N7O4/c1-21-9(18)8-13-10-11-2-6(4-16(10)14-8)15-5-7(3-12-15)17(19)20/h2-5H,1H3 |
| InChIKey | KDGCLACZYHKBCJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 130.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|