About N,N-dimethylethanamine;hydrochloride
N,N-dimethylethanamine;hydrochloride (PubChem CID 12556476) has the molecular formula C4H12ClN
and a molecular weight of 109.60 g/mol. Its IUPAC name is N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 12556476 |
| Molecular Formula | C4H12ClN |
| Molecular Weight | 109.60 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | N,N-dimethylethanamine;hydrochloride |
| SMILES | CCN(C)C.Cl |
| InChI | InChI=1S/C4H11N.ClH/c1-4-5(2)3;/h4H2,1-3H3;1H |
| InChIKey | KSKTVNNRMXUMIY-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.60 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;hydrochloride?
The IUPAC name of N,N-dimethylethanamine;hydrochloride (CID 12556476) is N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for N,N-dimethylethanamine;hydrochloride is CCN(C)C.Cl.
What is the InChIKey of N,N-dimethylethanamine;hydrochloride?
The InChIKey is KSKTVNNRMXUMIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.ClH/c1-4-5(2)3;/h4H2,1-3H3;1H.
What are the key properties of N,N-dimethylethanamine;hydrochloride?
N,N-dimethylethanamine;hydrochloride has a molecular weight of 109.60 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 12556476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).