About N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide
N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide (PubChem CID 12556871) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide |
| PubChem CID | 12556871 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide |
| SMILES | CC(=O)N(C)c1nc(C)co1 |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-11-7(8-5)9(3)6(2)10/h4H,1-3H3 |
| InChIKey | ZMUWBBZXNKHXTD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide?
The IUPAC name of N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide (CID 12556871) is N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide.
What is the SMILES notation for N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide?
The canonical SMILES for N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide is CC(=O)N(C)c1nc(C)co1.
What is the InChIKey of N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide?
The InChIKey is ZMUWBBZXNKHXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-4-11-7(8-5)9(3)6(2)10/h4H,1-3H3.
What are the key properties of N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide?
N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide has a molecular weight of 154.17 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-methyl-1,3-oxazol-2-yl)acetamide is sourced from PubChem (CID 12556871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).