About N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide
N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide (PubChem CID 12556872) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide.
Molecular Properties
| Compound Name | N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide |
| PubChem CID | 12556872 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide |
| SMILES | Cc1coc(N(C)C(=O)C(C)C)n1 |
| InChI | InChI=1S/C9H14N2O2/c1-6(2)8(12)11(4)9-10-7(3)5-13-9/h5-6H,1-4H3 |
| InChIKey | ICRWBBQXMVAKAK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide?
The IUPAC name of N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide (CID 12556872) is N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide.
What is the SMILES notation for N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide?
The canonical SMILES for N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide is Cc1coc(N(C)C(=O)C(C)C)n1.
What is the InChIKey of N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide?
The InChIKey is ICRWBBQXMVAKAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6(2)8(12)11(4)9-10-7(3)5-13-9/h5-6H,1-4H3.
What are the key properties of N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide?
N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide has a molecular weight of 182.22 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide is sourced from PubChem (CID 12556872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).