About N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide
N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide (PubChem CID 12556880) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide.
Molecular Properties
| Compound Name | N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide |
| PubChem CID | 12556880 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide |
| SMILES | CCCCN(C(=O)C(CC)CC)c1nc(C)co1 |
| InChI | InChI=1S/C14H24N2O2/c1-5-8-9-16(13(17)12(6-2)7-3)14-15-11(4)10-18-14/h10,12H,5-9H2,1-4H3 |
| InChIKey | OJPLOCHZOYBEIG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide?
The IUPAC name of N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide (CID 12556880) is N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide.
What is the SMILES notation for N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide?
The canonical SMILES for N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide is CCCCN(C(=O)C(CC)CC)c1nc(C)co1.
What is the InChIKey of N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide?
The InChIKey is OJPLOCHZOYBEIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-5-8-9-16(13(17)12(6-2)7-3)14-15-11(4)10-18-14/h10,12H,5-9H2,1-4H3.
What are the key properties of N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide?
N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide has a molecular weight of 252.36 g/mol, XLogP of 3.55, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-ethyl-N-(4-methyl-1,3-oxazol-2-yl)butanamide is sourced from PubChem (CID 12556880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).