About N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide
N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide (PubChem CID 12556881) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide |
| PubChem CID | 12556881 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide |
| SMILES | CCCCN(C(=O)C1CC1)c1nc(C)co1 |
| InChI | InChI=1S/C12H18N2O2/c1-3-4-7-14(11(15)10-5-6-10)12-13-9(2)8-16-12/h8,10H,3-7H2,1-2H3 |
| InChIKey | YSKPHODLBKBYJO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide?
The IUPAC name of N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide (CID 12556881) is N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide.
What is the SMILES notation for N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide?
The canonical SMILES for N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide is CCCCN(C(=O)C1CC1)c1nc(C)co1.
What is the InChIKey of N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide?
The InChIKey is YSKPHODLBKBYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-3-4-7-14(11(15)10-5-6-10)12-13-9(2)8-16-12/h8,10H,3-7H2,1-2H3.
What are the key properties of N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide?
N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide has a molecular weight of 222.29 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-(4-methyl-1,3-oxazol-2-yl)cyclopropanecarboxamide is sourced from PubChem (CID 12556881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).