About N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide
N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide (PubChem CID 12556908) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide |
| PubChem CID | 12556908 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)c1nc(C)c(C)o1 |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(2)12-8(9-5)10(4)7(3)11/h1-4H3 |
| InChIKey | WQGUCTZWZZAMQP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide?
The IUPAC name of N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide (CID 12556908) is N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide.
What is the SMILES notation for N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide?
The canonical SMILES for N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide is CC(=O)N(C)c1nc(C)c(C)o1.
What is the InChIKey of N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide?
The InChIKey is WQGUCTZWZZAMQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-6(2)12-8(9-5)10(4)7(3)11/h1-4H3.
What are the key properties of N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide?
N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide has a molecular weight of 168.20 g/mol, XLogP of 1.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethyl-1,3-oxazol-2-yl)-N-methylacetamide is sourced from PubChem (CID 12556908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).