About diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate
diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (PubChem CID 1255715) has the molecular formula C25H26FNO6
and a molecular weight of 455.48 g/mol. Its IUPAC name is diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| PubChem CID | 1255715 |
| Molecular Formula | C25H26FNO6 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN(c2cccc(F)c2)C=C(C(=O)OCC)C1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C25H26FNO6/c1-4-31-22-12-16(10-11-21(22)28)23-19(24(29)32-5-2)14-27(15-20(23)25(30)33-6-3)18-9-7-8-17(26)13-18/h7-15,23,28H,4-6H2,1-3H3 |
| InChIKey | RZMKWLPEQOANJI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate (CID 1255715) is diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=CN(c2cccc(F)c2)C=C(C(=O)OCC)C1c1ccc(O)c(OCC)c1.
What is the InChIKey of diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
The InChIKey is RZMKWLPEQOANJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26FNO6/c1-4-31-22-12-16(10-11-21(22)28)23-19(24(29)32-5-2)14-27(15-20(23)25(30)33-6-3)18-9-7-8-17(26)13-18/h7-15,23,28H,4-6H2,1-3H3.
What are the key properties of diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate?
diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate has a molecular weight of 455.48 g/mol, XLogP of 4.43, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(3-ethoxy-4-hydroxyphenyl)-1-(3-fluorophenyl)-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 1255715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).